C13H23N7 — CID 105318519
[1-(1,3-diethylpyrazol-5-yl)-2-(2-ethyl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 105318519) has the molecular formula C13H23N7 and a molecular weight of 277.38 g/mol. Its IUPAC name is [1-(1,3-diethylpyrazol-5-yl)-2-(2-ethyl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(1,3-diethylpyrazol-5-yl)-2-(2-ethyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105318519 |
| Molecular Formula | C13H23N7 |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | [1-(1,3-diethylpyrazol-5-yl)-2-(2-ethyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | CCc1cc(C(Cc2ncnn2CC)NN)n(CC)n1 |
| InChI | InChI=1S/C13H23N7/c1-4-10-7-12(19(5-2)18-10)11(17-14)8-13-15-9-16-20(13)6-3/h7,9,11,17H,4-6,8,14H2,1-3H3 |
| InChIKey | KRXIFXHLEBZRHH-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|