C10H16N6S — CID 105318476
[2-(2-ethyl-1,2,4-triazol-3-yl)-1-(4-methyl-1,3-thiazol-5-yl)ethyl]hydrazine (PubChem CID 105318476) has the molecular formula C10H16N6S and a molecular weight of 252.35 g/mol. Its IUPAC name is [2-(2-ethyl-1,2,4-triazol-3-yl)-1-(4-methyl-1,3-thiazol-5-yl)ethyl]hydrazine.
| Compound Name | [2-(2-ethyl-1,2,4-triazol-3-yl)-1-(4-methyl-1,3-thiazol-5-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105318476 |
| Molecular Formula | C10H16N6S |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | [2-(2-ethyl-1,2,4-triazol-3-yl)-1-(4-methyl-1,3-thiazol-5-yl)ethyl]hydrazine |
| SMILES | CCn1ncnc1CC(NN)c1scnc1C |
| InChI | InChI=1S/C10H16N6S/c1-3-16-9(12-5-14-16)4-8(15-11)10-7(2)13-6-17-10/h5-6,8,15H,3-4,11H2,1-2H3 |
| InChIKey | ONMZYJDDVSMJIW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|