C8H13N7S — CID 105318475
[2-(2-ethyl-1,2,4-triazol-3-yl)-1-(thiadiazol-4-yl)ethyl]hydrazine (PubChem CID 105318475) has the molecular formula C8H13N7S and a molecular weight of 239.31 g/mol. Its IUPAC name is [2-(2-ethyl-1,2,4-triazol-3-yl)-1-(thiadiazol-4-yl)ethyl]hydrazine.
| Compound Name | [2-(2-ethyl-1,2,4-triazol-3-yl)-1-(thiadiazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105318475 |
| Molecular Formula | C8H13N7S |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | [2-(2-ethyl-1,2,4-triazol-3-yl)-1-(thiadiazol-4-yl)ethyl]hydrazine |
| SMILES | CCn1ncnc1CC(NN)c1csnn1 |
| InChI | InChI=1S/C8H13N7S/c1-2-15-8(10-5-11-15)3-6(12-9)7-4-16-14-13-7/h4-6,12H,2-3,9H2,1H3 |
| InChIKey | TWGFCBFPROZCEH-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|