C9H14N6S — CID 105291319
[2-(1-ethylpyrazol-4-yl)-1-(thiadiazol-4-yl)ethyl]hydrazine (PubChem CID 105291319) has the molecular formula C9H14N6S and a molecular weight of 238.32 g/mol. Its IUPAC name is [2-(1-ethylpyrazol-4-yl)-1-(thiadiazol-4-yl)ethyl]hydrazine.
| Compound Name | [2-(1-ethylpyrazol-4-yl)-1-(thiadiazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105291319 |
| Molecular Formula | C9H14N6S |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | [2-(1-ethylpyrazol-4-yl)-1-(thiadiazol-4-yl)ethyl]hydrazine |
| SMILES | CCn1cc(CC(NN)c2csnn2)cn1 |
| InChI | InChI=1S/C9H14N6S/c1-2-15-5-7(4-11-15)3-8(12-10)9-6-16-14-13-9/h4-6,8,12H,2-3,10H2,1H3 |
| InChIKey | ZBZNPUXIQYDBFI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|