C8H12N6S — CID 105289774
[(1-ethylpyrazol-4-yl)-(thiadiazol-4-yl)methyl]hydrazine (PubChem CID 105289774) has the molecular formula C8H12N6S and a molecular weight of 224.29 g/mol. Its IUPAC name is [(1-ethylpyrazol-4-yl)-(thiadiazol-4-yl)methyl]hydrazine.
| Compound Name | [(1-ethylpyrazol-4-yl)-(thiadiazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105289774 |
| Molecular Formula | C8H12N6S |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | [(1-ethylpyrazol-4-yl)-(thiadiazol-4-yl)methyl]hydrazine |
| SMILES | CCn1cc(C(NN)c2csnn2)cn1 |
| InChI | InChI=1S/C8H12N6S/c1-2-14-4-6(3-10-14)8(11-9)7-5-15-13-12-7/h3-5,8,11H,2,9H2,1H3 |
| InChIKey | RORNWTOZEJXZLE-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|