C12H14Cl2N4 — CID 105289840
[(3,5-dichlorophenyl)-(1-ethylpyrazol-4-yl)methyl]hydrazine (PubChem CID 105289840) has the molecular formula C12H14Cl2N4 and a molecular weight of 285.18 g/mol. Its IUPAC name is [(3,5-dichlorophenyl)-(1-ethylpyrazol-4-yl)methyl]hydrazine.
| Compound Name | [(3,5-dichlorophenyl)-(1-ethylpyrazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105289840 |
| Molecular Formula | C12H14Cl2N4 |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | [(3,5-dichlorophenyl)-(1-ethylpyrazol-4-yl)methyl]hydrazine |
| SMILES | CCn1cc(C(NN)c2cc(Cl)cc(Cl)c2)cn1 |
| InChI | InChI=1S/C12H14Cl2N4/c1-2-18-7-9(6-16-18)12(17-15)8-3-10(13)5-11(14)4-8/h3-7,12,17H,2,15H2,1H3 |
| InChIKey | YDGVYWRDLTWTAI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|