C9H16N8 — CID 105254865
[2-(2-propyl-1,2,4-triazol-3-yl)-1-(2H-triazol-4-yl)ethyl]hydrazine (PubChem CID 105254865) has the molecular formula C9H16N8 and a molecular weight of 236.28 g/mol. Its IUPAC name is [2-(2-propyl-1,2,4-triazol-3-yl)-1-(2H-triazol-4-yl)ethyl]hydrazine.
| Compound Name | [2-(2-propyl-1,2,4-triazol-3-yl)-1-(2H-triazol-4-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105254865 |
| Molecular Formula | C9H16N8 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | [2-(2-propyl-1,2,4-triazol-3-yl)-1-(2H-triazol-4-yl)ethyl]hydrazine |
| SMILES | CCCn1ncnc1CC(NN)c1cn[nH]n1 |
| InChI | InChI=1S/C9H16N8/c1-2-3-17-9(11-6-13-17)4-7(14-10)8-5-12-16-15-8/h5-7,14H,2-4,10H2,1H3,(H,12,15,16) |
| InChIKey | MKVKAIKABZCKNF-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|