C12H17FN6 — CID 105257926
[1-(3-fluoro-2-pyridinyl)-2-(2-propyl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 105257926) has the molecular formula C12H17FN6 and a molecular weight of 264.31 g/mol. Its IUPAC name is [1-(3-fluoro-2-pyridinyl)-2-(2-propyl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(3-fluoro-2-pyridinyl)-2-(2-propyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105257926 |
| Molecular Formula | C12H17FN6 |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | [1-(3-fluoro-2-pyridinyl)-2-(2-propyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | CCCn1ncnc1CC(NN)c1ncccc1F |
| InChI | InChI=1S/C12H17FN6/c1-2-6-19-11(16-8-17-19)7-10(18-14)12-9(13)4-3-5-15-12/h3-5,8,10,18H,2,6-7,14H2,1H3 |
| InChIKey | KLCKJJSVFLCONO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|