C14H20BrN5 — CID 105319130
[1-(3-bromo-4-methylphenyl)-2-(2-propyl-1,2,4-triazol-3-yl)ethyl]hydrazine (PubChem CID 105319130) has the molecular formula C14H20BrN5 and a molecular weight of 338.25 g/mol. Its IUPAC name is [1-(3-bromo-4-methylphenyl)-2-(2-propyl-1,2,4-triazol-3-yl)ethyl]hydrazine.
| Compound Name | [1-(3-bromo-4-methylphenyl)-2-(2-propyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105319130 |
| Molecular Formula | C14H20BrN5 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | [1-(3-bromo-4-methylphenyl)-2-(2-propyl-1,2,4-triazol-3-yl)ethyl]hydrazine |
| SMILES | CCCn1ncnc1CC(NN)c1ccc(C)c(Br)c1 |
| InChI | InChI=1S/C14H20BrN5/c1-3-6-20-14(17-9-18-20)8-13(19-16)11-5-4-10(2)12(15)7-11/h4-5,7,9,13,19H,3,6,8,16H2,1-2H3 |
| InChIKey | KSIOJRRRQQYDTB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|