C13H16F3N5 — CID 105208183
[2-(2-propyl-1,2,4-triazol-3-yl)-1-(3,4,5-trifluorophenyl)ethyl]hydrazine (PubChem CID 105208183) has the molecular formula C13H16F3N5 and a molecular weight of 299.30 g/mol. Its IUPAC name is [2-(2-propyl-1,2,4-triazol-3-yl)-1-(3,4,5-trifluorophenyl)ethyl]hydrazine.
| Compound Name | [2-(2-propyl-1,2,4-triazol-3-yl)-1-(3,4,5-trifluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105208183 |
| Molecular Formula | C13H16F3N5 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [2-(2-propyl-1,2,4-triazol-3-yl)-1-(3,4,5-trifluorophenyl)ethyl]hydrazine |
| SMILES | CCCn1ncnc1CC(NN)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H16F3N5/c1-2-3-21-12(18-7-19-21)6-11(20-17)8-4-9(14)13(16)10(15)5-8/h4-5,7,11,20H,2-3,6,17H2,1H3 |
| InChIKey | LGQJJUQOJOECSF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|