C16H25N5 — CID 105324386
[1-(1,3-diethylpyrazol-5-yl)-2-(5-ethyl-2-pyridinyl)ethyl]hydrazine (PubChem CID 105324386) has the molecular formula C16H25N5 and a molecular weight of 287.41 g/mol. Its IUPAC name is [1-(1,3-diethylpyrazol-5-yl)-2-(5-ethyl-2-pyridinyl)ethyl]hydrazine.
| Compound Name | [1-(1,3-diethylpyrazol-5-yl)-2-(5-ethyl-2-pyridinyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105324386 |
| Molecular Formula | C16H25N5 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | [1-(1,3-diethylpyrazol-5-yl)-2-(5-ethyl-2-pyridinyl)ethyl]hydrazine |
| SMILES | CCc1ccc(CC(NN)c2cc(CC)nn2CC)nc1 |
| InChI | InChI=1S/C16H25N5/c1-4-12-7-8-14(18-11-12)9-15(19-17)16-10-13(5-2)20-21(16)6-3/h7-8,10-11,15,19H,4-6,9,17H2,1-3H3 |
| InChIKey | RWOPGYGQNSOJNI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|