C16H23N3O — CID 105115124
1-(1,3-diethylpyrazol-5-yl)-2-(5-ethyl-2-pyridinyl)ethanol (PubChem CID 105115124) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-(1,3-diethylpyrazol-5-yl)-2-(5-ethyl-2-pyridinyl)ethanol.
| Compound Name | 1-(1,3-diethylpyrazol-5-yl)-2-(5-ethyl-2-pyridinyl)ethanol |
|---|---|
| PubChem CID | 105115124 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 1-(1,3-diethylpyrazol-5-yl)-2-(5-ethyl-2-pyridinyl)ethanol |
| SMILES | CCc1ccc(CC(O)c2cc(CC)nn2CC)nc1 |
| InChI | InChI=1S/C16H23N3O/c1-4-12-7-8-14(17-11-12)10-16(20)15-9-13(5-2)18-19(15)6-3/h7-9,11,16,20H,4-6,10H2,1-3H3 |
| InChIKey | WMPZFWZNXIARHX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |