C16H23FN4 — CID 105377996
[1-(1,3-diethylpyrazol-5-yl)-2-(5-fluoro-2-methylphenyl)ethyl]hydrazine (PubChem CID 105377996) has the molecular formula C16H23FN4 and a molecular weight of 290.39 g/mol. Its IUPAC name is [1-(1,3-diethylpyrazol-5-yl)-2-(5-fluoro-2-methylphenyl)ethyl]hydrazine.
| Compound Name | [1-(1,3-diethylpyrazol-5-yl)-2-(5-fluoro-2-methylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105377996 |
| Molecular Formula | C16H23FN4 |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | [1-(1,3-diethylpyrazol-5-yl)-2-(5-fluoro-2-methylphenyl)ethyl]hydrazine |
| SMILES | CCc1cc(C(Cc2cc(F)ccc2C)NN)n(CC)n1 |
| InChI | InChI=1S/C16H23FN4/c1-4-14-10-16(21(5-2)20-14)15(19-18)9-12-8-13(17)7-6-11(12)3/h6-8,10,15,19H,4-5,9,18H2,1-3H3 |
| InChIKey | QDUWWHDCWLLJOE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|