C15H17Cl2N3 — CID 105257061
[1-(3,4-dichlorophenyl)-2-(5-ethyl-2-pyridinyl)ethyl]hydrazine (PubChem CID 105257061) has the molecular formula C15H17Cl2N3 and a molecular weight of 310.23 g/mol. Its IUPAC name is [1-(3,4-dichlorophenyl)-2-(5-ethyl-2-pyridinyl)ethyl]hydrazine.
| Compound Name | [1-(3,4-dichlorophenyl)-2-(5-ethyl-2-pyridinyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105257061 |
| Molecular Formula | C15H17Cl2N3 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | [1-(3,4-dichlorophenyl)-2-(5-ethyl-2-pyridinyl)ethyl]hydrazine |
| SMILES | CCc1ccc(CC(NN)c2ccc(Cl)c(Cl)c2)nc1 |
| InChI | InChI=1S/C15H17Cl2N3/c1-2-10-3-5-12(19-9-10)8-15(20-18)11-4-6-13(16)14(17)7-11/h3-7,9,15,20H,2,8,18H2,1H3 |
| InChIKey | GEZOYXYPWVEYBL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|