About (2-propyl-1,2,4-triazol-3-yl)methanamine;hydrochloride
(2-propyl-1,2,4-triazol-3-yl)methanamine;hydrochloride (PubChem CID 139026277) has the molecular formula C6H13ClN4
and a molecular weight of 176.65 g/mol. Its IUPAC name is (2-propyl-1,2,4-triazol-3-yl)methanamine;hydrochloride.
Analyze (2-propyl-1,2,4-triazol-3-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-propyl-1,2,4-triazol-3-yl)methanamine;hydrochloride?
The IUPAC name of (2-propyl-1,2,4-triazol-3-yl)methanamine;hydrochloride (CID 139026277) is (2-propyl-1,2,4-triazol-3-yl)methanamine;hydrochloride.
What is the SMILES notation for (2-propyl-1,2,4-triazol-3-yl)methanamine;hydrochloride?
The canonical SMILES for (2-propyl-1,2,4-triazol-3-yl)methanamine;hydrochloride is CCCn1ncnc1CN.Cl.
What is the InChIKey of (2-propyl-1,2,4-triazol-3-yl)methanamine;hydrochloride?
The InChIKey is DQOMIUPGHFHRIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4.ClH/c1-2-3-10-6(4-7)8-5-9-10;/h5H,2-4,7H2,1H3;1H.
What are the key properties of (2-propyl-1,2,4-triazol-3-yl)methanamine;hydrochloride?
(2-propyl-1,2,4-triazol-3-yl)methanamine;hydrochloride has a molecular weight of 176.65 g/mol, XLogP of 0.57, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-propyl-1,2,4-triazol-3-yl)methanamine;hydrochloride is sourced from PubChem (CID 139026277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).