C9H18N4O2 — CID 103412848
[2-[3-(2-methoxyethoxy)propyl]-1,2,4-triazol-3-yl]methanamine (PubChem CID 103412848) has the molecular formula C9H18N4O2 and a molecular weight of 214.27 g/mol. Its IUPAC name is [2-[3-(2-methoxyethoxy)propyl]-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [2-[3-(2-methoxyethoxy)propyl]-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 103412848 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | [2-[3-(2-methoxyethoxy)propyl]-1,2,4-triazol-3-yl]methanamine |
| SMILES | COCCOCCCn1ncnc1CN |
| InChI | InChI=1S/C9H18N4O2/c1-14-5-6-15-4-2-3-13-9(7-10)11-8-12-13/h8H,2-7,10H2,1H3 |
| InChIKey | GMBQVMONCHWJQD-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|