About [2-(4-phenylbutyl)-1,2,4-triazol-3-yl]methanamine
[2-(4-phenylbutyl)-1,2,4-triazol-3-yl]methanamine (PubChem CID 114334607) has the molecular formula C13H18N4
and a molecular weight of 230.32 g/mol. Its IUPAC name is [2-(4-phenylbutyl)-1,2,4-triazol-3-yl]methanamine.
Molecular Properties
| Compound Name | [2-(4-phenylbutyl)-1,2,4-triazol-3-yl]methanamine |
| PubChem CID | 114334607 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.32 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | [2-(4-phenylbutyl)-1,2,4-triazol-3-yl]methanamine |
| SMILES | NCc1ncnn1CCCCc1ccccc1 |
| InChI | InChI=1S/C13H18N4/c14-10-13-15-11-16-17(13)9-5-4-8-12-6-2-1-3-7-12/h1-3,6-7,11H,4-5,8-10,14H2 |
| InChIKey | HIIAECASDZIIDX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-phenylbutyl)-1,2,4-triazol-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-phenylbutyl)-1,2,4-triazol-3-yl]methanamine?
The IUPAC name of [2-(4-phenylbutyl)-1,2,4-triazol-3-yl]methanamine (CID 114334607) is [2-(4-phenylbutyl)-1,2,4-triazol-3-yl]methanamine.
What is the SMILES notation for [2-(4-phenylbutyl)-1,2,4-triazol-3-yl]methanamine?
The canonical SMILES for [2-(4-phenylbutyl)-1,2,4-triazol-3-yl]methanamine is NCc1ncnn1CCCCc1ccccc1.
What is the InChIKey of [2-(4-phenylbutyl)-1,2,4-triazol-3-yl]methanamine?
The InChIKey is HIIAECASDZIIDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4/c14-10-13-15-11-16-17(13)9-5-4-8-12-6-2-1-3-7-12/h1-3,6-7,11H,4-5,8-10,14H2.
What are the key properties of [2-(4-phenylbutyl)-1,2,4-triazol-3-yl]methanamine?
[2-(4-phenylbutyl)-1,2,4-triazol-3-yl]methanamine has a molecular weight of 230.32 g/mol, XLogP of 1.76, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-phenylbutyl)-1,2,4-triazol-3-yl]methanamine is sourced from PubChem (CID 114334607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).