C19H23N5 — CID 111034361
1-(3,4-dimethylphenyl)-2-[2-(2-methylbenzimidazol-1-yl)ethyl]guanidine (PubChem CID 111034361) has the molecular formula C19H23N5 and a molecular weight of 321.43 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-[2-(2-methylbenzimidazol-1-yl)ethyl]guanidine.
| Compound Name | 1-(3,4-dimethylphenyl)-2-[2-(2-methylbenzimidazol-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111034361 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-[2-(2-methylbenzimidazol-1-yl)ethyl]guanidine |
| SMILES | Cc1ccc(N/C(N)=N/CCn2c(C)nc3ccccc32)cc1C |
| InChI | InChI=1S/C19H23N5/c1-13-8-9-16(12-14(13)2)23-19(20)21-10-11-24-15(3)22-17-6-4-5-7-18(17)24/h4-9,12H,10-11H2,1-3H3,(H3,20,21,23) |
| InChIKey | RNZHPGFIEQNQFC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|