C18H21N5O — CID 111824835
1-(3,4-dimethylphenyl)-2-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]guanidine (PubChem CID 111824835) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]guanidine.
| Compound Name | 1-(3,4-dimethylphenyl)-2-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111824835 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]guanidine |
| SMILES | Cc1ccc(N/C(N)=N/CCn2c(=O)[nH]c3ccccc32)cc1C |
| InChI | InChI=1S/C18H21N5O/c1-12-7-8-14(11-13(12)2)21-17(19)20-9-10-23-16-6-4-3-5-15(16)22-18(23)24/h3-8,11H,9-10H2,1-2H3,(H,22,24)(H3,19,20,21) |
| InChIKey | ZMBVILHGGNITFD-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|