C10H16IN5 — CID 137072714
1-prop-2-enyl-2-(2-pyrazin-2-ylethyl)guanidine;hydroiodide (PubChem CID 137072714) has the molecular formula C10H16IN5 and a molecular weight of 333.18 g/mol. Its IUPAC name is 1-prop-2-enyl-2-(2-pyrazin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-prop-2-enyl-2-(2-pyrazin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 137072714 |
| Molecular Formula | C10H16IN5 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 1-prop-2-enyl-2-(2-pyrazin-2-ylethyl)guanidine;hydroiodide |
| SMILES | C=CCN/C(N)=N/CCc1cnccn1.I |
| InChI | InChI=1S/C10H15N5.HI/c1-2-4-14-10(11)15-5-3-9-8-12-6-7-13-9;/h2,6-8H,1,3-5H2,(H3,11,14,15);1H |
| InChIKey | ABYRMPCOEDNBME-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|