C9H14N4S — CID 111465365
2-[(5-methyl-1,3-thiazol-2-yl)methyl]-1-prop-2-enylguanidine (PubChem CID 111465365) has the molecular formula C9H14N4S and a molecular weight of 210.31 g/mol. Its IUPAC name is 2-[(5-methyl-1,3-thiazol-2-yl)methyl]-1-prop-2-enylguanidine.
| Compound Name | 2-[(5-methyl-1,3-thiazol-2-yl)methyl]-1-prop-2-enylguanidine |
|---|---|
| PubChem CID | 111465365 |
| Molecular Formula | C9H14N4S |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-[(5-methyl-1,3-thiazol-2-yl)methyl]-1-prop-2-enylguanidine |
| SMILES | C=CCN/C(N)=N/Cc1ncc(C)s1 |
| InChI | InChI=1S/C9H14N4S/c1-3-4-11-9(10)13-6-8-12-5-7(2)14-8/h3,5H,1,4,6H2,2H3,(H3,10,11,13) |
| InChIKey | QIFGTKLKRIEVBE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|