C13H19N3 — CID 111456477
2-[(2-ethylphenyl)methyl]-1-prop-2-enylguanidine (PubChem CID 111456477) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 2-[(2-ethylphenyl)methyl]-1-prop-2-enylguanidine.
| Compound Name | 2-[(2-ethylphenyl)methyl]-1-prop-2-enylguanidine |
|---|---|
| PubChem CID | 111456477 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 2-[(2-ethylphenyl)methyl]-1-prop-2-enylguanidine |
| SMILES | C=CCN/C(N)=N/Cc1ccccc1CC |
| InChI | InChI=1S/C13H19N3/c1-3-9-15-13(14)16-10-12-8-6-5-7-11(12)4-2/h3,5-8H,1,4,9-10H2,2H3,(H3,14,15,16) |
| InChIKey | RCGOWKGTTZAIRT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|