C12H18N4O — CID 120602824
2-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]-1-prop-2-enylguanidine (PubChem CID 120602824) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]-1-prop-2-enylguanidine.
| Compound Name | 2-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]-1-prop-2-enylguanidine |
|---|---|
| PubChem CID | 120602824 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]-1-prop-2-enylguanidine |
| SMILES | C=CCN/C(N)=N/Cc1ccc(C)n(C)c1=O |
| InChI | InChI=1S/C12H18N4O/c1-4-7-14-12(13)15-8-10-6-5-9(2)16(3)11(10)17/h4-6H,1,7-8H2,2-3H3,(H3,13,14,15) |
| InChIKey | QKRYLYUVFTWGCO-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 72.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|