C13H20N4O2S — CID 110914558
2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-prop-2-enylguanidine (PubChem CID 110914558) has the molecular formula C13H20N4O2S and a molecular weight of 296.40 g/mol. Its IUPAC name is 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-prop-2-enylguanidine.
| Compound Name | 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-prop-2-enylguanidine |
|---|---|
| PubChem CID | 110914558 |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-prop-2-enylguanidine |
| SMILES | C=CCN/C(N)=N/Cc1ccccc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C13H20N4O2S/c1-4-9-15-13(14)16-10-11-7-5-6-8-12(11)20(18,19)17(2)3/h4-8H,1,9-10H2,2-3H3,(H3,14,15,16) |
| InChIKey | GBVJQKQCFCYDAC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|