C18H29N5O3S — CID 110963881
4-acetyl-N'-[[2-(dimethylsulfamoyl)phenyl]methyl]-N-ethylpiperazine-1-carboximidamide (PubChem CID 110963881) has the molecular formula C18H29N5O3S and a molecular weight of 395.53 g/mol. Its IUPAC name is 4-acetyl-N'-[[2-(dimethylsulfamoyl)phenyl]methyl]-N-ethylpiperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N'-[[2-(dimethylsulfamoyl)phenyl]methyl]-N-ethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110963881 |
| Molecular Formula | C18H29N5O3S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 4-acetyl-N'-[[2-(dimethylsulfamoyl)phenyl]methyl]-N-ethylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccccc1S(=O)(=O)N(C)C)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C18H29N5O3S/c1-5-19-18(23-12-10-22(11-13-23)15(2)24)20-14-16-8-6-7-9-17(16)27(25,26)21(3)4/h6-9H,5,10-14H2,1-4H3,(H,19,20) |
| InChIKey | XWBFPXWHZLTBBG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|