C24H40IN5O — CID 110964100
4-acetyl-N'-[[2-[[cyclohexyl(methyl)amino]methyl]phenyl]methyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 110964100) has the molecular formula C24H40IN5O and a molecular weight of 541.52 g/mol. Its IUPAC name is 4-acetyl-N'-[[2-[[cyclohexyl(methyl)amino]methyl]phenyl]methyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-acetyl-N'-[[2-[[cyclohexyl(methyl)amino]methyl]phenyl]methyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110964100 |
| Molecular Formula | C24H40IN5O |
| Molecular Weight | 541.52 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 4-acetyl-N'-[[2-[[cyclohexyl(methyl)amino]methyl]phenyl]methyl]-N-ethylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1CN(C)C1CCCCC1)N1CCN(C(C)=O)CC1.I |
| InChI | InChI=1S/C24H39N5O.HI/c1-4-25-24(29-16-14-28(15-17-29)20(2)30)26-18-21-10-8-9-11-22(21)19-27(3)23-12-6-5-7-13-23;/h8-11,23H,4-7,12-19H2,1-3H3,(H,25,26);1H |
| InChIKey | ARHWOQHDEWMNEN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|