C24H39IN4O2 — CID 111252888
methyl 1-[N-[[2-[[cyclohexyl(methyl)amino]methyl]phenyl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111252888) has the molecular formula C24H39IN4O2 and a molecular weight of 542.51 g/mol. Its IUPAC name is methyl 1-[N-[[2-[[cyclohexyl(methyl)amino]methyl]phenyl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N-[[2-[[cyclohexyl(methyl)amino]methyl]phenyl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111252888 |
| Molecular Formula | C24H39IN4O2 |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | methyl 1-[N-[[2-[[cyclohexyl(methyl)amino]methyl]phenyl]methyl]-N'-methylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCc1ccccc1CN(C)C1CCCCC1)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C24H38N4O2.HI/c1-25-24(28-15-13-19(14-16-28)23(29)30-3)26-17-20-9-7-8-10-21(20)18-27(2)22-11-5-4-6-12-22;/h7-10,19,22H,4-6,11-18H2,1-3H3,(H,25,26);1H |
| InChIKey | NTZCDPLVELYYKB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|