C16H29IN4O3 — CID 119131071
methyl 1-[N'-methyl-N-(2-oxo-2-piperidin-1-ylethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 119131071) has the molecular formula C16H29IN4O3 and a molecular weight of 452.34 g/mol. Its IUPAC name is methyl 1-[N'-methyl-N-(2-oxo-2-piperidin-1-ylethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N'-methyl-N-(2-oxo-2-piperidin-1-ylethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 119131071 |
| Molecular Formula | C16H29IN4O3 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | methyl 1-[N'-methyl-N-(2-oxo-2-piperidin-1-ylethyl)carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCC(=O)N1CCCCC1)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C16H28N4O3.HI/c1-17-16(18-12-14(21)19-8-4-3-5-9-19)20-10-6-13(7-11-20)15(22)23-2;/h13H,3-12H2,1-2H3,(H,17,18);1H |
| InChIKey | KBQXPUKAUHKENO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|