C16H31IN4O2 — CID 111958694
4-ethoxy-N'-methyl-N-(2-oxo-2-piperidin-1-ylethyl)piperidine-1-carboximidamide;hydroiodide (PubChem CID 111958694) has the molecular formula C16H31IN4O2 and a molecular weight of 438.35 g/mol. Its IUPAC name is 4-ethoxy-N'-methyl-N-(2-oxo-2-piperidin-1-ylethyl)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-ethoxy-N'-methyl-N-(2-oxo-2-piperidin-1-ylethyl)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111958694 |
| Molecular Formula | C16H31IN4O2 |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 4-ethoxy-N'-methyl-N-(2-oxo-2-piperidin-1-ylethyl)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCOC1CCN(/C(=N/C)NCC(=O)N2CCCCC2)CC1.I |
| InChI | InChI=1S/C16H30N4O2.HI/c1-3-22-14-7-11-20(12-8-14)16(17-2)18-13-15(21)19-9-5-4-6-10-19;/h14H,3-13H2,1-2H3,(H,17,18);1H |
| InChIKey | GCKWREFJILXEKQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|