C15H29N3O3 — CID 111960285
methyl 5-[[C-(4-ethoxypiperidin-1-yl)-N-methylcarbonimidoyl]amino]pentanoate (PubChem CID 111960285) has the molecular formula C15H29N3O3 and a molecular weight of 299.41 g/mol. Its IUPAC name is methyl 5-[[C-(4-ethoxypiperidin-1-yl)-N-methylcarbonimidoyl]amino]pentanoate.
| Compound Name | methyl 5-[[C-(4-ethoxypiperidin-1-yl)-N-methylcarbonimidoyl]amino]pentanoate |
|---|---|
| PubChem CID | 111960285 |
| Molecular Formula | C15H29N3O3 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | methyl 5-[[C-(4-ethoxypiperidin-1-yl)-N-methylcarbonimidoyl]amino]pentanoate |
| SMILES | CCOC1CCN(/C(=N/C)NCCCCC(=O)OC)CC1 |
| InChI | InChI=1S/C15H29N3O3/c1-4-21-13-8-11-18(12-9-13)15(16-2)17-10-6-5-7-14(19)20-3/h13H,4-12H2,1-3H3,(H,16,17) |
| InChIKey | UWZYCTFBAPUNPI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|