C15H30IN3O3 — CID 75532609
methyl 6-[[C-(2,6-dimethylmorpholin-4-yl)-N-methylcarbonimidoyl]amino]hexanoate;hydroiodide (PubChem CID 75532609) has the molecular formula C15H30IN3O3 and a molecular weight of 427.33 g/mol. Its IUPAC name is methyl 6-[[C-(2,6-dimethylmorpholin-4-yl)-N-methylcarbonimidoyl]amino]hexanoate;hydroiodide.
| Compound Name | methyl 6-[[C-(2,6-dimethylmorpholin-4-yl)-N-methylcarbonimidoyl]amino]hexanoate;hydroiodide |
|---|---|
| PubChem CID | 75532609 |
| Molecular Formula | C15H30IN3O3 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | methyl 6-[[C-(2,6-dimethylmorpholin-4-yl)-N-methylcarbonimidoyl]amino]hexanoate;hydroiodide |
| SMILES | C/N=C(\NCCCCCC(=O)OC)N1CC(C)OC(C)C1.I |
| InChI | InChI=1S/C15H29N3O3.HI/c1-12-10-18(11-13(2)21-12)15(16-3)17-9-7-5-6-8-14(19)20-4;/h12-13H,5-11H2,1-4H3,(H,16,17);1H |
| InChIKey | BEYWZYFFCLTYIQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|