C25H39IN6 — CID 111740451
N-[[2-[[cyclohexyl(methyl)amino]methyl]phenyl]methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111740451) has the molecular formula C25H39IN6 and a molecular weight of 550.53 g/mol. Its IUPAC name is N-[[2-[[cyclohexyl(methyl)amino]methyl]phenyl]methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[[2-[[cyclohexyl(methyl)amino]methyl]phenyl]methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111740451 |
| Molecular Formula | C25H39IN6 |
| Molecular Weight | 550.53 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | N-[[2-[[cyclohexyl(methyl)amino]methyl]phenyl]methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccccc1CN(C)C1CCCCC1)N1CCC(c2cnn(C)c2)C1.I |
| InChI | InChI=1S/C25H38N6.HI/c1-26-25(31-14-13-22(19-31)23-16-28-30(3)18-23)27-15-20-9-7-8-10-21(20)17-29(2)24-11-5-4-6-12-24;/h7-10,16,18,22,24H,4-6,11-15,17,19H2,1-3H3,(H,26,27);1H |
| InChIKey | GLBVTADBQJZPJU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|