C24H37IN6 — CID 111740585
N-[[4-[cyclohexyl(methyl)amino]phenyl]methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111740585) has the molecular formula C24H37IN6 and a molecular weight of 536.51 g/mol. Its IUPAC name is N-[[4-[cyclohexyl(methyl)amino]phenyl]methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[[4-[cyclohexyl(methyl)amino]phenyl]methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111740585 |
| Molecular Formula | C24H37IN6 |
| Molecular Weight | 536.51 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | N-[[4-[cyclohexyl(methyl)amino]phenyl]methyl]-N'-methyl-3-(1-methylpyrazol-4-yl)pyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(N(C)C2CCCCC2)cc1)N1CCC(c2cnn(C)c2)C1.I |
| InChI | InChI=1S/C24H36N6.HI/c1-25-24(30-14-13-20(18-30)21-16-27-28(2)17-21)26-15-19-9-11-23(12-10-19)29(3)22-7-5-4-6-8-22;/h9-12,16-17,20,22H,4-8,13-15,18H2,1-3H3,(H,25,26);1H |
| InChIKey | ZTXGRVJNHNVIGD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|