C20H33N5O4S — CID 111328850
ethyl 4-[[N'-[[2-(dimethylsulfamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111328850) has the molecular formula C20H33N5O4S and a molecular weight of 439.58 g/mol. Its IUPAC name is ethyl 4-[[N'-[[2-(dimethylsulfamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[[2-(dimethylsulfamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111328850 |
| Molecular Formula | C20H33N5O4S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | ethyl 4-[[N'-[[2-(dimethylsulfamoyl)phenyl]methyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1ccccc1S(=O)(=O)N(C)C)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C20H33N5O4S/c1-5-21-19(23-17-11-13-25(14-12-17)20(26)29-6-2)22-15-16-9-7-8-10-18(16)30(27,28)24(3)4/h7-10,17H,5-6,11-15H2,1-4H3,(H2,21,22,23) |
| InChIKey | MPNZUUCFUSUNSZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|