C18H30N4O2S2 — CID 111530637
2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine (PubChem CID 111530637) has the molecular formula C18H30N4O2S2 and a molecular weight of 398.60 g/mol. Its IUPAC name is 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine.
| Compound Name | 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine |
|---|---|
| PubChem CID | 111530637 |
| Molecular Formula | C18H30N4O2S2 |
| Molecular Weight | 398.60 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2-[[2-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1S(=O)(=O)N(C)C)NC1CCC(SC)C1 |
| InChI | InChI=1S/C18H30N4O2S2/c1-5-19-18(21-15-10-11-16(12-15)25-4)20-13-14-8-6-7-9-17(14)26(23,24)22(2)3/h6-9,15-16H,5,10-13H2,1-4H3,(H2,19,20,21) |
| InChIKey | USZSJCZIOUAVKN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.60 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|