C19H33IN4S — CID 111528172
2-[2-[benzyl(methyl)amino]ethyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide (PubChem CID 111528172) has the molecular formula C19H33IN4S and a molecular weight of 476.47 g/mol. Its IUPAC name is 2-[2-[benzyl(methyl)amino]ethyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide.
| Compound Name | 2-[2-[benzyl(methyl)amino]ethyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111528172 |
| Molecular Formula | C19H33IN4S |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 2-[2-[benzyl(methyl)amino]ethyl]-1-ethyl-3-(3-methylsulfanylcyclopentyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN(C)Cc1ccccc1)NC1CCC(SC)C1.I |
| InChI | InChI=1S/C19H32N4S.HI/c1-4-20-19(22-17-10-11-18(14-17)24-3)21-12-13-23(2)15-16-8-6-5-7-9-16;/h5-9,17-18H,4,10-15H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | CBMHFFAYBIGZJQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|