C18H31IN4O2S2 — CID 109489386
N'-[[2-(dimethylsulfamoyl)phenyl]methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109489386) has the molecular formula C18H31IN4O2S2 and a molecular weight of 526.51 g/mol. Its IUPAC name is N'-[[2-(dimethylsulfamoyl)phenyl]methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[[2-(dimethylsulfamoyl)phenyl]methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109489386 |
| Molecular Formula | C18H31IN4O2S2 |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | N'-[[2-(dimethylsulfamoyl)phenyl]methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1S(=O)(=O)N(C)C)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C18H30N4O2S2.HI/c1-6-19-17(22-11-12-25-18(2,3)14-22)20-13-15-9-7-8-10-16(15)26(23,24)21(4)5;/h7-10H,6,11-14H2,1-5H3,(H,19,20);1H |
| InChIKey | CUBJKNBLEKFUDD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|