C20H34N4OS — CID 109489523
N'-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide (PubChem CID 109489523) has the molecular formula C20H34N4OS and a molecular weight of 378.59 g/mol. Its IUPAC name is N'-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide.
| Compound Name | N'-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109489523 |
| Molecular Formula | C20H34N4OS |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | N'-[[3-[2-(dimethylamino)ethoxy]phenyl]methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccc(OCCN(C)C)c1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C20H34N4OS/c1-6-21-19(24-11-13-26-20(2,3)16-24)22-15-17-8-7-9-18(14-17)25-12-10-23(4)5/h7-9,14H,6,10-13,15-16H2,1-5H3,(H,21,22) |
| InChIKey | KEERCJDEETXLDX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|