C21H33N5OS — CID 109488752
N-[3-[[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide (PubChem CID 109488752) has the molecular formula C21H33N5OS and a molecular weight of 403.60 g/mol. Its IUPAC name is N-[3-[[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[3-[[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 109488752 |
| Molecular Formula | C21H33N5OS |
| Molecular Weight | 403.60 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | N-[3-[[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)N2CCCC2)c1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C21H33N5OS/c1-4-22-19(26-12-13-28-21(2,3)16-26)23-15-17-8-7-9-18(14-17)24-20(27)25-10-5-6-11-25/h7-9,14H,4-6,10-13,15-16H2,1-3H3,(H,22,23)(H,24,27) |
| InChIKey | RUGIFPJSZYCCBQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|