C19H30IN3O3S — CID 109489588
methyl 5-[[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide (PubChem CID 109489588) has the molecular formula C19H30IN3O3S and a molecular weight of 507.44 g/mol. Its IUPAC name is methyl 5-[[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide.
| Compound Name | methyl 5-[[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide |
|---|---|
| PubChem CID | 109489588 |
| Molecular Formula | C19H30IN3O3S |
| Molecular Weight | 507.44 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | methyl 5-[[[(2,2-dimethylthiomorpholin-4-yl)-(ethylamino)methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(C(=O)OC)c1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C19H29N3O3S.HI/c1-6-20-18(22-9-10-26-19(2,3)13-22)21-12-14-7-8-16(24-4)15(11-14)17(23)25-5;/h7-8,11H,6,9-10,12-13H2,1-5H3,(H,20,21);1H |
| InChIKey | FORXUQTXGRDDON-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|