C17H26FN3OS — CID 109490077
N-ethyl-N'-[[4-fluoro-3-(hydroxymethyl)phenyl]methyl]-2,2-dimethylthiomorpholine-4-carboximidamide (PubChem CID 109490077) has the molecular formula C17H26FN3OS and a molecular weight of 339.48 g/mol. Its IUPAC name is N-ethyl-N'-[[4-fluoro-3-(hydroxymethyl)phenyl]methyl]-2,2-dimethylthiomorpholine-4-carboximidamide.
| Compound Name | N-ethyl-N'-[[4-fluoro-3-(hydroxymethyl)phenyl]methyl]-2,2-dimethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109490077 |
| Molecular Formula | C17H26FN3OS |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-ethyl-N'-[[4-fluoro-3-(hydroxymethyl)phenyl]methyl]-2,2-dimethylthiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(F)c(CO)c1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C17H26FN3OS/c1-4-19-16(21-7-8-23-17(2,3)12-21)20-10-13-5-6-15(18)14(9-13)11-22/h5-6,9,22H,4,7-8,10-12H2,1-3H3,(H,19,20) |
| InChIKey | OZQVIIRPHZMDAS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|