C15H26N4S2 — CID 109489427
N-ethyl-N'-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2,2-dimethylthiomorpholine-4-carboximidamide (PubChem CID 109489427) has the molecular formula C15H26N4S2 and a molecular weight of 326.54 g/mol. Its IUPAC name is N-ethyl-N'-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2,2-dimethylthiomorpholine-4-carboximidamide.
| Compound Name | N-ethyl-N'-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2,2-dimethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109489427 |
| Molecular Formula | C15H26N4S2 |
| Molecular Weight | 326.54 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-ethyl-N'-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2,2-dimethylthiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\Cc1ncc(CC)s1)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C15H26N4S2/c1-5-12-9-17-13(21-12)10-18-14(16-6-2)19-7-8-20-15(3,4)11-19/h9H,5-8,10-11H2,1-4H3,(H,16,18) |
| InChIKey | HVDOHHNJNRGPPV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|