C14H27IN6S — CID 109489258
N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109489258) has the molecular formula C14H27IN6S and a molecular weight of 438.38 g/mol. Its IUPAC name is N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109489258 |
| Molecular Formula | C14H27IN6S |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc(C)n1C)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C14H26N6S.HI/c1-6-15-13(20-7-8-21-14(3,4)10-20)16-9-12-18-17-11(2)19(12)5;/h6-10H2,1-5H3,(H,15,16);1H |
| InChIKey | SZQDZQWCRRUNMJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|