C16H30IN5OS — CID 109488804
N'-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109488804) has the molecular formula C16H30IN5OS and a molecular weight of 467.42 g/mol. Its IUPAC name is N'-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109488804 |
| Molecular Formula | C16H30IN5OS |
| Molecular Weight | 467.42 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | N'-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1noc(C(C)(C)C)n1)N1CCSC(C)(C)C1.I |
| InChI | InChI=1S/C16H29N5OS.HI/c1-7-17-14(21-8-9-23-16(5,6)11-21)18-10-12-19-13(22-20-12)15(2,3)4;/h7-11H2,1-6H3,(H,17,18);1H |
| InChIKey | JCSZIMLVSCCGJF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|