C21H38IN5O3 — CID 109448498
N'-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109448498) has the molecular formula C21H38IN5O3 and a molecular weight of 535.47 g/mol. Its IUPAC name is N'-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109448498 |
| Molecular Formula | C21H38IN5O3 |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | N'-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-N-ethyl-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1noc(C(C)(C)C)n1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C21H37N5O3.HI/c1-5-22-20(23-14-18-24-19(29-25-18)21(2,3)4)26-11-9-16(10-12-26)28-15-17-8-6-7-13-27-17;/h16-17H,5-15H2,1-4H3,(H,22,23);1H |
| InChIKey | XKFNFRYBRICTTM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|