C14H23F2N5S — CID 109488584
N'-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide (PubChem CID 109488584) has the molecular formula C14H23F2N5S and a molecular weight of 331.44 g/mol. Its IUPAC name is N'-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide.
| Compound Name | N'-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109488584 |
| Molecular Formula | C14H23F2N5S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N'-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-ethyl-2,2-dimethylthiomorpholine-4-carboximidamide |
| SMILES | CCN/C(=N\Cc1nccn1C(F)F)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C14H23F2N5S/c1-4-17-13(20-7-8-22-14(2,3)10-20)19-9-11-18-5-6-21(11)12(15)16/h5-6,12H,4,7-10H2,1-3H3,(H,17,19) |
| InChIKey | CMFZCTNJZCPESY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|