C15H23F2N5O2 — CID 111253029
methyl 1-[N'-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 111253029) has the molecular formula C15H23F2N5O2 and a molecular weight of 343.38 g/mol. Its IUPAC name is methyl 1-[N'-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N'-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111253029 |
| Molecular Formula | C15H23F2N5O2 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | methyl 1-[N'-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\Cc1nccn1C(F)F)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C15H23F2N5O2/c1-3-18-15(20-10-12-19-6-9-22(12)14(16)17)21-7-4-11(5-8-21)13(23)24-2/h6,9,11,14H,3-5,7-8,10H2,1-2H3,(H,18,20) |
| InChIKey | VIMKFYYTLXDJSB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|