C19H25F2N5 — CID 111724573
3-benzyl-N'-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-ethylpyrrolidine-1-carboximidamide (PubChem CID 111724573) has the molecular formula C19H25F2N5 and a molecular weight of 361.44 g/mol. Its IUPAC name is 3-benzyl-N'-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-ethylpyrrolidine-1-carboximidamide.
| Compound Name | 3-benzyl-N'-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-ethylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111724573 |
| Molecular Formula | C19H25F2N5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 3-benzyl-N'-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-ethylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1nccn1C(F)F)N1CCC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H25F2N5/c1-2-22-19(24-13-17-23-9-11-26(17)18(20)21)25-10-8-16(14-25)12-15-6-4-3-5-7-15/h3-7,9,11,16,18H,2,8,10,12-14H2,1H3,(H,22,24) |
| InChIKey | CEUKSUVQKCRCIP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|