C18H22F3N5 — CID 119143672
N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-[(4-fluorophenyl)methyl]-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 119143672) has the molecular formula C18H22F3N5 and a molecular weight of 365.40 g/mol. Its IUPAC name is N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-[(4-fluorophenyl)methyl]-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-[(4-fluorophenyl)methyl]-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 119143672 |
| Molecular Formula | C18H22F3N5 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | N-[[1-(difluoromethyl)imidazol-2-yl]methyl]-3-[(4-fluorophenyl)methyl]-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1nccn1C(F)F)N1CCC(Cc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H22F3N5/c1-22-18(24-11-16-23-7-9-26(16)17(20)21)25-8-6-14(12-25)10-13-2-4-15(19)5-3-13/h2-5,7,9,14,17H,6,8,10-12H2,1H3,(H,22,24) |
| InChIKey | NJENTKZMCCPKET-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|