C19H26F2N6O — CID 111290425
N'-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-ethyl-4-(3-methoxyphenyl)piperazine-1-carboximidamide (PubChem CID 111290425) has the molecular formula C19H26F2N6O and a molecular weight of 392.45 g/mol. Its IUPAC name is N'-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-ethyl-4-(3-methoxyphenyl)piperazine-1-carboximidamide.
| Compound Name | N'-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-ethyl-4-(3-methoxyphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111290425 |
| Molecular Formula | C19H26F2N6O |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N'-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-ethyl-4-(3-methoxyphenyl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1nccn1C(F)F)N1CCN(c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C19H26F2N6O/c1-3-22-19(24-14-17-23-7-8-27(17)18(20)21)26-11-9-25(10-12-26)15-5-4-6-16(13-15)28-2/h4-8,13,18H,3,9-12,14H2,1-2H3,(H,22,24) |
| InChIKey | GUPVRNIEZDYSML-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 57.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|